adelo77 adelo77
  • 03-11-2019
  • Mathematics
contestada

cosec(6b+pi/8)=sec(2b-pi/8)​

Respuesta :

2002hemal
2002hemal 2002hemal
  • 03-11-2019

Step-by-step explanation:

cosec( 6b+ pie/8)=sec(2b-pie/8)

1/ sin( 6b +pie/8)=1/sec(2b-pie/8)

cos(2b-pie/8)=sin(6b-pie/8)

cosX =sin(pie/2-x)

sin(pie/2-2b+pie/8)=sin(6b+pie/8)

pie/2-2b+pie/8=6b+pie/8

pie/2=8b

b = pie/16

Ver imagen 2002hemal
Answer Link

Otras preguntas

Why was capturing egypt's suez canal so important to the axis powers?
what were some of the problems that led to the rise of dictators in germany ,italy ,and japan?
Which text exemplifies the anti-Victorianism prevalent in the early twentieth century? a) Eminent Victorians b) Jungle Books c) Philistine Victorians d) The
what type of reaction produces a metal from its metal oxide
What is 10 percent of 80
If A+B=76  and A -B=38 whats A divided by B
how do I figure out what 5550/1000
Why did the americans go to Oregon during manifest destiny and why did the mormon go to utah??
How do I solve this equation? If 3t-7=5t then 6t=a 21b-7c-21d-42
57% of 109 is what number? plz help