mialugardo mialugardo

16-02-2022
Mathematics

contestada

Find the exact value of expression Sin(100)cos(40)-cos(100)sin(40)

Respuesta :

MagicBoiGoku MagicBoiGoku

16-02-2022

Answer: The answer is 1/2

Answer Link

Otras preguntas

If f(x)=x^2+9x and g(x)=3x+1 find f(g(x)) and g(f(x))

what is a dinosaur that still lives among us today? readworks answers

Write an expression equivalent tox^2+6x-7x

What point has the coordinates

Select the correct answer. What determines the average kinetic energy of the particles in a gas? A. The number of collisions B. The number of particles C. The s

which macromolecules has a nitrogen base and phosphate found in its structure?

Animal cells do not have cell walls. true or false

Leah multiplied the number 2 by itself 4 times (2x2x2x2). Deshon multiplied the number 4 by itself 2 times (4x4). Which product is greater? Explain.

To make a batch of salad dressing, combine 6 tablespoons of oil with 12 tablespoons of vinegar. How many tablespoons of vinegar are needed for every tablespoon

simplify the expression :)