mateo10 mateo10
  • 03-11-2015
  • Mathematics
contestada

In 5 to the 7th power what is the 5 called

Respuesta :

Percy2Chase
Percy2Chase Percy2Chase
  • 03-11-2015
5 to the 7th  power or is basically 5 seven times, it's NOT 5 times 7, it's 5x5x5x5x5x5x5 = 78,125 or  = 78,125. You just say 5 to the 7th power. 


Answer Link
TSO
TSO TSO
  • 03-11-2015
The 5 is called the base.

The 7 is called the exponent.
Answer Link

Otras preguntas

Specific location where earthquake has struck?
cosec(6b+pi/8)=sec(2b-pi/8)​
explain five (5) contributions of the manufacturing industry to industrialization​
find y-intercept and x-intercept. 2x+3y=6
Does the sentence state a fact or an opinion? The number of students who say that they spend over three hours a night on homework is unacceptable.
When would workers not be covered under the Occupational Safety and Health Act? O A. If they work in an inherently dangerous field. O B. If they are covered by
Which statement below is true only for homogeneous catalysts? a. A homogeneous catalyst is a solid substance to which liquid or gaseous reactants will adhere to
2H+C+T+2B= I Ned Dmv the answer
Explain how the power of the Court is balanced or limited.
if 3/4 of the 12 pencils were sharpened then how many pencils were sharpened​